C22H22F3N3O7 — CID 167285981
(1S,3R,8R,9S,10R,12R)-6,6-dimethyl-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-2,5,7,11,16-pentaoxatetracyclo[11.2.1.01,10.03,8]hexadecane-12-carboxylic acid (PubChem CID 167285981) has the molecular formula C22H22F3N3O7 and a molecular weight of 497.43 g/mol. Its IUPAC name is (1S,3R,8R,9S,10R,12R)-6,6-dimethyl-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-2,5,7,11,16-pentaoxatetracyclo[11.2.1.01,10.03,8]hexadecane-12-carboxylic acid.
| Compound Name | (1S,3R,8R,9S,10R,12R)-6,6-dimethyl-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-2,5,7,11,16-pentaoxatetracyclo[11.2.1.01,10.03,8]hexadecane-12-carboxylic acid |
|---|---|
| PubChem CID | 167285981 |
| Molecular Formula | C22H22F3N3O7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (1S,3R,8R,9S,10R,12R)-6,6-dimethyl-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-2,5,7,11,16-pentaoxatetracyclo[11.2.1.01,10.03,8]hexadecane-12-carboxylic acid |
| SMILES | CC1(C)OC[C@H]2O[C@]34CCC(O3)[C@H](C(=O)O)O[C@@H]4[C@@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)[C@H]2O1 |
| InChI | InChI=1S/C22H22F3N3O7/c1-21(2)31-8-14-17(35-21)16(19-22(34-14)4-3-13(33-22)18(32-19)20(29)30)28-7-12(26-27-28)9-5-10(23)15(25)11(24)6-9/h5-7,13-14,16-19H,3-4,8H2,1-2H3,(H,29,30)/t13?,14-,16+,17+,18-,19-,22+/m1/s1 |
| InChIKey | KFTUMJUFKOFFFB-QQHPDCEVSA-N |
| XLogP | 2.18 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|