C24H21F3N4O5S — CID 155194515
(2R,3R,4S,5R,6R)-N-(1-benzothiophen-6-yl)-3,5-dihydroxy-6-(hydroxymethyl)-N-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide (PubChem CID 155194515) has the molecular formula C24H21F3N4O5S and a molecular weight of 534.52 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(1-benzothiophen-6-yl)-3,5-dihydroxy-6-(hydroxymethyl)-N-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(1-benzothiophen-6-yl)-3,5-dihydroxy-6-(hydroxymethyl)-N-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 155194515 |
| Molecular Formula | C24H21F3N4O5S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(1-benzothiophen-6-yl)-3,5-dihydroxy-6-(hydroxymethyl)-N-methyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
| SMILES | CN(C(=O)[C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O)c1ccc2ccsc2c1 |
| InChI | InChI=1S/C24H21F3N4O5S/c1-30(13-3-2-11-4-5-37-18(11)8-13)24(35)23-22(34)20(21(33)17(10-32)36-23)31-9-16(28-29-31)12-6-14(25)19(27)15(26)7-12/h2-9,17,20-23,32-34H,10H2,1H3/t17-,20+,21+,22-,23-/m1/s1 |
| InChIKey | POGGXQIHLCAQJL-SUHOFRIBSA-N |
| XLogP | 2.26 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|