C24H22Cl2FN5O5S — CID 162662900
(2R,3R,4S,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(3,4-dichloro-2-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxy-N-methyloxane-2-carboxamide (PubChem CID 162662900) has the molecular formula C24H22Cl2FN5O5S and a molecular weight of 582.44 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(3,4-dichloro-2-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxy-N-methyloxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(3,4-dichloro-2-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxy-N-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 162662900 |
| Molecular Formula | C24H22Cl2FN5O5S |
| Molecular Weight | 582.44 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(3,4-dichloro-2-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-3-methoxy-N-methyloxane-2-carboxamide |
| SMILES | CO[C@@H]1C(n2cc(-c3ccc(Cl)c(Cl)c3F)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(C)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C24H22Cl2FN5O5S/c1-31(11-3-6-14-17(7-11)38-10-28-14)24(35)23-22(36-2)20(21(34)16(9-33)37-23)32-8-15(29-30-32)12-4-5-13(25)18(26)19(12)27/h3-8,10,16,20-23,33-34H,9H2,1-2H3/t16-,20?,21+,22-,23-/m1/s1 |
| InChIKey | HJFUZTRJZDWWPG-COQINHEUSA-N |
| XLogP | 3.34 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|