C25H24ClF2N5O4S — CID 167063422
(2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-propan-2-yloxane-2-carboxamide (PubChem CID 167063422) has the molecular formula C25H24ClF2N5O4S and a molecular weight of 564.01 g/mol. Its IUPAC name is (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-propan-2-yloxane-2-carboxamide.
| Compound Name | (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-propan-2-yloxane-2-carboxamide |
|---|---|
| PubChem CID | 167063422 |
| Molecular Formula | C25H24ClF2N5O4S |
| Molecular Weight | 564.01 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(4-chloro-3,5-difluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-propan-2-yloxane-2-carboxamide |
| SMILES | CC(C)N(C(=O)[C@H]1CC(n2cc(-c3cc(F)c(Cl)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C25H24ClF2N5O4S/c1-12(2)33(14-3-4-17-22(7-14)38-11-29-17)25(36)20-8-19(24(35)21(10-34)37-20)32-9-18(30-31-32)13-5-15(27)23(26)16(28)6-13/h3-7,9,11-12,19-21,24,34-35H,8,10H2,1-2H3/t19?,20-,21-,24-/m1/s1 |
| InChIKey | INKVARNAQDZZKX-VIMIFYJLSA-N |
| XLogP | 3.98 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|