C24H24BrF2N5O4S — CID 155708979
N-(1,3-benzothiazol-6-yl)-N-methylformamide;4-[4-(4-bromo-3,5-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-6-methyloxan-3-ol (PubChem CID 155708979) has the molecular formula C24H24BrF2N5O4S and a molecular weight of 596.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-N-methylformamide;4-[4-(4-bromo-3,5-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-6-methyloxan-3-ol.
| Compound Name | N-(1,3-benzothiazol-6-yl)-N-methylformamide;4-[4-(4-bromo-3,5-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 155708979 |
| Molecular Formula | C24H24BrF2N5O4S |
| Molecular Weight | 596.45 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-N-methylformamide;4-[4-(4-bromo-3,5-difluorophenyl)triazol-1-yl]-2-(hydroxymethyl)-6-methyloxan-3-ol |
| SMILES | CC1CC(n2cc(-c3cc(F)c(Br)c(F)c3)nn2)C(O)C(CO)O1.CN(C=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C15H16BrF2N3O3.C9H8N2OS/c1-7-2-12(15(23)13(6-22)24-7)21-5-11(19-20-21)8-3-9(17)14(16)10(18)4-8;1-11(6-12)7-2-3-8-9(4-7)13-5-10-8/h3-5,7,12-13,15,22-23H,2,6H2,1H3;2-6H,1H3 |
| InChIKey | VBJKOEJWYQNKNE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|