C25H23Cl2F3N4O6 — CID 163273824
(2R,3R,4S,5R,6R)-N-(3,5-dichlorophenyl)-3,5-dihydroxy-N-[(1S,2S)-2-hydroxycyclobutyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide (PubChem CID 163273824) has the molecular formula C25H23Cl2F3N4O6 and a molecular weight of 603.38 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(3,5-dichlorophenyl)-3,5-dihydroxy-N-[(1S,2S)-2-hydroxycyclobutyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(3,5-dichlorophenyl)-3,5-dihydroxy-N-[(1S,2S)-2-hydroxycyclobutyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 163273824 |
| Molecular Formula | C25H23Cl2F3N4O6 |
| Molecular Weight | 603.38 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(3,5-dichlorophenyl)-3,5-dihydroxy-N-[(1S,2S)-2-hydroxycyclobutyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-2-carboxamide |
| SMILES | O=C([C@@H]1O[C@H](CO)[C@H](O)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O)N(c1cc(Cl)cc(Cl)c1)[C@H]1CC[C@@H]1O |
| InChI | InChI=1S/C25H23Cl2F3N4O6/c26-11-5-12(27)7-13(6-11)34(17-1-2-18(17)36)25(39)24-23(38)21(22(37)19(9-35)40-24)33-8-16(31-32-33)10-3-14(28)20(30)15(29)4-10/h3-8,17-19,21-24,35-38H,1-2,9H2/t17-,18-,19+,21-,22-,23+,24+/m0/s1 |
| InChIKey | AOOBXQOZBHWXIG-GYCQFFSMSA-N |
| XLogP | 2.25 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|