C27H25Cl2F3N4O7 — CID 163273860
[(2R,3R,4S,5R,6R)-2-[(3,5-dichlorophenyl)-[(1S,2S)-2-hydroxycyclobutyl]carbamoyl]-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate (PubChem CID 163273860) has the molecular formula C27H25Cl2F3N4O7 and a molecular weight of 645.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[(3,5-dichlorophenyl)-[(1S,2S)-2-hydroxycyclobutyl]carbamoyl]-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[(3,5-dichlorophenyl)-[(1S,2S)-2-hydroxycyclobutyl]carbamoyl]-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 163273860 |
| Molecular Formula | C27H25Cl2F3N4O7 |
| Molecular Weight | 645.42 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[(3,5-dichlorophenyl)-[(1S,2S)-2-hydroxycyclobutyl]carbamoyl]-5-hydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(c1cc(Cl)cc(Cl)c1)[C@H]1CC[C@@H]1O |
| InChI | InChI=1S/C27H25Cl2F3N4O7/c1-11(38)42-25-23(35-9-18(33-34-35)12-4-16(30)22(32)17(31)5-12)24(40)21(10-37)43-26(25)27(41)36(19-2-3-20(19)39)15-7-13(28)6-14(29)8-15/h4-9,19-21,23-26,37,39-40H,2-3,10H2,1H3/t19-,20-,21+,23-,24-,25+,26+/m0/s1 |
| InChIKey | IWMUENWOKMSZLK-VLPMDROOSA-N |
| XLogP | 2.82 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|