C34H28F3N7O5S — CID 142552368
ethyl 4-(2-methyl-1,3-benzothiazol-6-yl)-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole-3-carboxylate (PubChem CID 142552368) has the molecular formula C34H28F3N7O5S and a molecular weight of 703.70 g/mol. Its IUPAC name is ethyl 4-(2-methyl-1,3-benzothiazol-6-yl)-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 4-(2-methyl-1,3-benzothiazol-6-yl)-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 142552368 |
| Molecular Formula | C34H28F3N7O5S |
| Molecular Weight | 703.70 g/mol |
| Exact Mass | 703.18 |
| IUPAC Name | ethyl 4-(2-methyl-1,3-benzothiazol-6-yl)-5-[2-phenyl-8-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1nnc(C2CC(n3cc(-c4cc(F)c(F)c(F)c4)nn3)C3OC(c4ccccc4)OCC3O2)n1-c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C34H28F3N7O5S/c1-3-46-33(45)32-41-40-31(44(32)20-9-10-23-28(13-20)50-17(2)38-23)26-14-25(30-27(48-26)16-47-34(49-30)18-7-5-4-6-8-18)43-15-24(39-42-43)19-11-21(35)29(37)22(36)12-19/h4-13,15,25-27,30,34H,3,14,16H2,1-2H3 |
| InChIKey | UBQFCMKISSLEJD-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 128.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.70 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|