C29H26ClN7O4S2 — CID 155570864
4-[1-[(6R,8aR)-6-[(5-chloro-2-pyridin-4-yl-3-pyridinyl)sulfanyl]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazol-2-amine (PubChem CID 155570864) has the molecular formula C29H26ClN7O4S2 and a molecular weight of 636.16 g/mol. Its IUPAC name is 4-[1-[(6R,8aR)-6-[(5-chloro-2-pyridin-4-yl-3-pyridinyl)sulfanyl]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-[1-[(6R,8aR)-6-[(5-chloro-2-pyridin-4-yl-3-pyridinyl)sulfanyl]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155570864 |
| Molecular Formula | C29H26ClN7O4S2 |
| Molecular Weight | 636.16 g/mol |
| Exact Mass | 635.12 |
| IUPAC Name | 4-[1-[(6R,8aR)-6-[(5-chloro-2-pyridin-4-yl-3-pyridinyl)sulfanyl]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazol-2-amine |
| SMILES | COC1C(n2cc(-c3csc(N)n3)nn2)[C@H]2OC(c3ccccc3)OCC2O[C@@H]1Sc1cc(Cl)cnc1-c1ccncc1 |
| InChI | InChI=1S/C29H26ClN7O4S2/c1-38-26-24(37-13-19(35-36-37)20-15-42-29(31)34-20)25-21(14-39-27(41-25)17-5-3-2-4-6-17)40-28(26)43-22-11-18(30)12-33-23(22)16-7-9-32-10-8-16/h2-13,15,21,24-28H,14H2,1H3,(H2,31,34)/t21?,24?,25-,26?,27?,28+/m0/s1 |
| InChIKey | VPDOOFZVCRSCEM-LRYKQBMJSA-N |
| XLogP | 5.28 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.16 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |