C26H23ClN6O4S2 — CID 166587161
2-[1-[(6R,8S,8aR)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazole (PubChem CID 166587161) has the molecular formula C26H23ClN6O4S2 and a molecular weight of 583.10 g/mol. Its IUPAC name is 2-[1-[(6R,8S,8aR)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazole.
| Compound Name | 2-[1-[(6R,8S,8aR)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 166587161 |
| Molecular Formula | C26H23ClN6O4S2 |
| Molecular Weight | 583.10 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 2-[1-[(6R,8S,8aR)-6-[(5-chloro-2-isocyano-3-pyridinyl)sulfanyl]-7-ethoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]triazol-4-yl]-1,3-thiazole |
| SMILES | [C-]#[N+]c1ncc(Cl)cc1S[C@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](n2cc(-c3nccs3)nn2)C1OCC |
| InChI | InChI=1S/C26H23ClN6O4S2/c1-3-34-22-20(33-13-17(31-32-33)24-29-9-10-38-24)21-18(14-35-25(37-21)15-7-5-4-6-8-15)36-26(22)39-19-11-16(27)12-30-23(19)28-2/h4-13,18,20-22,25-26H,3,14H2,1H3/t18?,20-,21-,22?,25?,26+/m0/s1 |
| InChIKey | IZZQHSMMRKRHGM-ASCJQABUSA-N |
| XLogP | 5.58 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|