C20H22ClN5O5S — CID 174038400
(6R,8aR)-8-azido-6-[[5-chloro-2-[hydroxy(methylamino)methyl]-3-pyridinyl]sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 174038400) has the molecular formula C20H22ClN5O5S and a molecular weight of 479.95 g/mol. Its IUPAC name is (6R,8aR)-8-azido-6-[[5-chloro-2-[hydroxy(methylamino)methyl]-3-pyridinyl]sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6R,8aR)-8-azido-6-[[5-chloro-2-[hydroxy(methylamino)methyl]-3-pyridinyl]sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 174038400 |
| Molecular Formula | C20H22ClN5O5S |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (6R,8aR)-8-azido-6-[[5-chloro-2-[hydroxy(methylamino)methyl]-3-pyridinyl]sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | CNC(O)c1ncc(Cl)cc1S[C@H]1OC2COC(c3ccccc3)O[C@@H]2C(N=[N+]=[N-])C1O |
| InChI | InChI=1S/C20H22ClN5O5S/c1-23-18(28)14-13(7-11(21)8-24-14)32-20-16(27)15(25-26-22)17-12(30-20)9-29-19(31-17)10-5-3-2-4-6-10/h2-8,12,15-20,23,27-28H,9H2,1H3/t12?,15?,16?,17-,18?,19?,20+/m0/s1 |
| InChIKey | NNJICFWCFHRWFX-XWPOGHGCSA-N |
| XLogP | 2.92 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|