C20H17ClF3N3O4S — CID 166587065
(6R,7S,8aR)-8-azido-6-[3-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 166587065) has the molecular formula C20H17ClF3N3O4S and a molecular weight of 487.89 g/mol. Its IUPAC name is (6R,7S,8aR)-8-azido-6-[3-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6R,7S,8aR)-8-azido-6-[3-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 166587065 |
| Molecular Formula | C20H17ClF3N3O4S |
| Molecular Weight | 487.89 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | (6R,7S,8aR)-8-azido-6-[3-chloro-4-(trifluoromethyl)phenyl]sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | [N-]=[N+]=NC1[C@H]2OC(c3ccccc3)OCC2O[C@H](Sc2ccc(C(F)(F)F)c(Cl)c2)[C@H]1O |
| InChI | InChI=1S/C20H17ClF3N3O4S/c21-13-8-11(6-7-12(13)20(22,23)24)32-19-16(28)15(26-27-25)17-14(30-19)9-29-18(31-17)10-4-2-1-3-5-10/h1-8,14-19,28H,9H2/t14?,15?,16-,17-,18?,19+/m0/s1 |
| InChIKey | OCQPMFRYUPOQJE-CYANLIPSSA-N |
| XLogP | 5.33 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|