C21H18Cl2F3N3O4S — CID 166587142
(6R,8S,8aR)-8-azido-6-(3,4-dichlorophenyl)sulfanyl-2-phenyl-7-(2,2,2-trifluoroethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 166587142) has the molecular formula C21H18Cl2F3N3O4S and a molecular weight of 536.36 g/mol. Its IUPAC name is (6R,8S,8aR)-8-azido-6-(3,4-dichlorophenyl)sulfanyl-2-phenyl-7-(2,2,2-trifluoroethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (6R,8S,8aR)-8-azido-6-(3,4-dichlorophenyl)sulfanyl-2-phenyl-7-(2,2,2-trifluoroethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 166587142 |
| Molecular Formula | C21H18Cl2F3N3O4S |
| Molecular Weight | 536.36 g/mol |
| Exact Mass | 535.03 |
| IUPAC Name | (6R,8S,8aR)-8-azido-6-(3,4-dichlorophenyl)sulfanyl-2-phenyl-7-(2,2,2-trifluoroethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | [N-]=[N+]=N[C@@H]1C(OCC(F)(F)F)[C@@H](Sc2ccc(Cl)c(Cl)c2)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C21H18Cl2F3N3O4S/c22-13-7-6-12(8-14(13)23)34-20-18(31-10-21(24,25)26)16(28-29-27)17-15(32-20)9-30-19(33-17)11-4-2-1-3-5-11/h1-8,15-20H,9-10H2/t15?,16-,17-,18?,19?,20+/m0/s1 |
| InChIKey | ZSOBYOFXOAOPOH-LNPFTANKSA-N |
| XLogP | 6.55 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.36 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|