C19H17BrFN3O4S — CID 175239137
(4aR,6R,7R,8R,8aR)-8-azido-6-(5-bromo-2-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 175239137) has the molecular formula C19H17BrFN3O4S and a molecular weight of 482.33 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aR)-8-azido-6-(5-bromo-2-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (4aR,6R,7R,8R,8aR)-8-azido-6-(5-bromo-2-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 175239137 |
| Molecular Formula | C19H17BrFN3O4S |
| Molecular Weight | 482.33 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | (4aR,6R,7R,8R,8aR)-8-azido-6-(5-bromo-2-fluorophenyl)sulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](O)[C@@H](Sc2cc(Br)ccc2F)O[C@@H]2COC(c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C19H17BrFN3O4S/c20-11-6-7-12(21)14(8-11)29-19-16(25)15(23-24-22)17-13(27-19)9-26-18(28-17)10-4-2-1-3-5-10/h1-8,13,15-19,25H,9H2/t13-,15-,16-,17+,18?,19-/m1/s1 |
| InChIKey | IOGUKOLEUJJOQT-MSDJQAFZSA-N |
| XLogP | 4.56 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|