C23H23BrN4O5S — CID 162699950
[2-[[(6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-bromophenyl]-(azetidin-1-yl)methanone (PubChem CID 162699950) has the molecular formula C23H23BrN4O5S and a molecular weight of 547.43 g/mol. Its IUPAC name is [2-[[(6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-bromophenyl]-(azetidin-1-yl)methanone.
| Compound Name | [2-[[(6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-bromophenyl]-(azetidin-1-yl)methanone |
|---|---|
| PubChem CID | 162699950 |
| Molecular Formula | C23H23BrN4O5S |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | [2-[[(6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]sulfanyl]-4-bromophenyl]-(azetidin-1-yl)methanone |
| SMILES | [N-]=[N+]=N[C@@H]1C(O)[C@@H](Sc2cc(Br)ccc2C(=O)N2CCC2)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C23H23BrN4O5S/c24-14-7-8-15(21(30)28-9-4-10-28)17(11-14)34-23-19(29)18(26-27-25)20-16(32-23)12-31-22(33-20)13-5-2-1-3-6-13/h1-3,5-8,11,16,18-20,22-23,29H,4,9-10,12H2/t16?,18-,19?,20+,22?,23-/m1/s1 |
| InChIKey | GOJSRJXUHRDVPK-IFKJNGKMSA-N |
| XLogP | 4.27 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|