C15H17N3O6 — CID 164848593
methyl (6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 164848593) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is methyl (6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | methyl (6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 164848593 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | methyl (6R,8R,8aR)-8-azido-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1OC2COC(c3ccccc3)O[C@@H]2[C@H](N=[N+]=[N-])C1O |
| InChI | InChI=1S/C15H17N3O6/c1-21-14(20)13-11(19)10(17-18-16)12-9(23-13)7-22-15(24-12)8-5-3-2-4-6-8/h2-6,9-13,15,19H,7H2,1H3/t9?,10-,11?,12+,13-,15?/m1/s1 |
| InChIKey | TVAFIGGTGXAEJD-RWJNITSWSA-N |
| XLogP | 1.08 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|