C16H20O6 — CID 155573215
methyl (6R,8aR)-7-hydroxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate (PubChem CID 155573215) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (6R,8aR)-7-hydroxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate.
| Compound Name | methyl (6R,8aR)-7-hydroxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 155573215 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl (6R,8aR)-7-hydroxy-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(C)C1O |
| InChI | InChI=1S/C16H20O6/c1-9-12(17)14(15(18)19-2)21-11-8-20-16(22-13(9)11)10-6-4-3-5-7-10/h3-7,9,11-14,16-17H,8H2,1-2H3/t9?,11?,12?,13-,14-,16?/m1/s1 |
| InChIKey | DZMXVXQFDUKCEW-ZWXUWLCZSA-N |
| XLogP | 1.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |