C14H18N2O5 — CID 167154170
8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide (PubChem CID 167154170) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide.
| Compound Name | 8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
|---|---|
| PubChem CID | 167154170 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
| SMILES | NC(=O)C1OC2COC(c3ccccc3)OC2C(N)C1O |
| InChI | InChI=1S/C14H18N2O5/c15-9-10(17)12(13(16)18)20-8-6-19-14(21-11(8)9)7-4-2-1-3-5-7/h1-5,8-12,14,17H,6,15H2,(H2,16,18) |
| InChIKey | XFROBEGHQRDGNW-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |