C21H23Br2N5O4 — CID 164563158
8-amino-N-(1-aminoethylidene)-N'-(2,5-dibromo-3-pyridinyl)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboximidamide (PubChem CID 164563158) has the molecular formula C21H23Br2N5O4 and a molecular weight of 569.25 g/mol. Its IUPAC name is 8-amino-N-(1-aminoethylidene)-N'-(2,5-dibromo-3-pyridinyl)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboximidamide.
| Compound Name | 8-amino-N-(1-aminoethylidene)-N'-(2,5-dibromo-3-pyridinyl)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboximidamide |
|---|---|
| PubChem CID | 164563158 |
| Molecular Formula | C21H23Br2N5O4 |
| Molecular Weight | 569.25 g/mol |
| Exact Mass | 567.01 |
| IUPAC Name | 8-amino-N-(1-aminoethylidene)-N'-(2,5-dibromo-3-pyridinyl)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboximidamide |
| SMILES | C/C(N)=N\C(=N\c1cc(Br)cnc1Br)C1OC2COC(c3ccccc3)OC2C(N)C1O |
| InChI | InChI=1S/C21H23Br2N5O4/c1-10(24)27-20(28-13-7-12(22)8-26-19(13)23)18-16(29)15(25)17-14(31-18)9-30-21(32-17)11-5-3-2-4-6-11/h2-8,14-18,21,29H,9,25H2,1H3,(H2,24,27,28) |
| InChIKey | DAZWWLNKZLIESJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|