C23H22BrN5O4 — CID 164563084
2-[5-[(6S,8aR)-8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-3-methyl-1,2,4-triazol-1-yl]-4-bromobenzonitrile (PubChem CID 164563084) has the molecular formula C23H22BrN5O4 and a molecular weight of 512.36 g/mol. Its IUPAC name is 2-[5-[(6S,8aR)-8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-3-methyl-1,2,4-triazol-1-yl]-4-bromobenzonitrile.
| Compound Name | 2-[5-[(6S,8aR)-8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-3-methyl-1,2,4-triazol-1-yl]-4-bromobenzonitrile |
|---|---|
| PubChem CID | 164563084 |
| Molecular Formula | C23H22BrN5O4 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 2-[5-[(6S,8aR)-8-amino-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-3-methyl-1,2,4-triazol-1-yl]-4-bromobenzonitrile |
| SMILES | Cc1nc([C@@H]2OC3COC(c4ccccc4)O[C@@H]3C(N)C2O)n(-c2cc(Br)ccc2C#N)n1 |
| InChI | InChI=1S/C23H22BrN5O4/c1-12-27-22(29(28-12)16-9-15(24)8-7-14(16)10-25)21-19(30)18(26)20-17(32-21)11-31-23(33-20)13-5-3-2-4-6-13/h2-9,17-21,23,30H,11,26H2,1H3/t17?,18?,19?,20-,21+,23?/m0/s1 |
| InChIKey | ZRCAOIXWUQSFDU-YHOVTRPMSA-N |
| XLogP | 2.45 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |