C20H19NO5 — CID 166449629
3-[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]benzonitrile (PubChem CID 166449629) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]benzonitrile.
| Compound Name | 3-[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 166449629 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-[(4aR,6S,7R,8R,8aS)-7,8-dihydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(C2O[C@@H]3COC(c4ccccc4)O[C@H]3[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C20H19NO5/c21-10-12-5-4-8-14(9-12)18-16(22)17(23)19-15(25-18)11-24-20(26-19)13-6-2-1-3-7-13/h1-9,15-20,22-23H,11H2/t15-,16-,17-,18?,19-,20?/m1/s1 |
| InChIKey | NDTOKSROJMIBRJ-CPBNEPLPSA-N |
| XLogP | 1.83 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |