C21H20BrF3N5O3P — CID 164563221
(8R)-6-[2-[5-bromo-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[4,5-e][1,3]oxaphosphinin-8-amine (PubChem CID 164563221) has the molecular formula C21H20BrF3N5O3P and a molecular weight of 558.30 g/mol. Its IUPAC name is (8R)-6-[2-[5-bromo-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[4,5-e][1,3]oxaphosphinin-8-amine.
| Compound Name | (8R)-6-[2-[5-bromo-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[4,5-e][1,3]oxaphosphinin-8-amine |
|---|---|
| PubChem CID | 164563221 |
| Molecular Formula | C21H20BrF3N5O3P |
| Molecular Weight | 558.30 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | (8R)-6-[2-[5-bromo-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[4,5-e][1,3]oxaphosphinin-8-amine |
| SMILES | Cc1nc(C2OC3COC(c4ccccc4)OC3[C@H](N)P2)n(-c2cc(Br)cnc2C(F)(F)F)n1 |
| InChI | InChI=1S/C21H20BrF3N5O3P/c1-10-28-18(30(29-10)13-7-12(22)8-27-16(13)21(23,24)25)20-32-14-9-31-19(11-5-3-2-4-6-11)33-15(14)17(26)34-20/h2-8,14-15,17,19-20,34H,9,26H2,1H3/t14?,15?,17-,19?,20?/m1/s1 |
| InChIKey | KVEXIMXDMQURHT-KVRNTEONSA-N |
| XLogP | 4.23 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|