C25H27ClN4O4 — CID 174020453
(6S,8aR)-6-[2-(5-chloro-2-cyclopropyl-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 174020453) has the molecular formula C25H27ClN4O4 and a molecular weight of 482.97 g/mol. Its IUPAC name is (6S,8aR)-6-[2-(5-chloro-2-cyclopropyl-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8aR)-6-[2-(5-chloro-2-cyclopropyl-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 174020453 |
| Molecular Formula | C25H27ClN4O4 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | (6S,8aR)-6-[2-(5-chloro-2-cyclopropyl-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]-8-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | Cc1nc([C@@H]2OC3COC(c4ccccc4)O[C@@H]3C(C)C2O)n(-c2cc(Cl)cnc2C2CC2)n1 |
| InChI | InChI=1S/C25H27ClN4O4/c1-13-21(31)23(33-19-12-32-25(34-22(13)19)16-6-4-3-5-7-16)24-28-14(2)29-30(24)18-10-17(26)11-27-20(18)15-8-9-15/h3-7,10-11,13,15,19,21-23,25,31H,8-9,12H2,1-2H3/t13?,19?,21?,22-,23-,25?/m1/s1 |
| InChIKey | FGURIBWTINHYLB-KQZNAPCFSA-N |
| XLogP | 4.05 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |