C29H34F3N5O6 — CID 167154148
tert-butyl N-[[7-hydroxy-6-[5-methyl-2-[5-methyl-2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]amino]carbamate (PubChem CID 167154148) has the molecular formula C29H34F3N5O6 and a molecular weight of 605.61 g/mol. Its IUPAC name is tert-butyl N-[[7-hydroxy-6-[5-methyl-2-[5-methyl-2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[7-hydroxy-6-[5-methyl-2-[5-methyl-2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]amino]carbamate |
|---|---|
| PubChem CID | 167154148 |
| Molecular Formula | C29H34F3N5O6 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | tert-butyl N-[[7-hydroxy-6-[5-methyl-2-[5-methyl-2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]amino]carbamate |
| SMILES | Cc1ccc(C(F)(F)F)c(-n2nc(C)nc2C2OC3COC(c4ccccc4)OC3C(NNC(=O)OC(C)(C)C)C2O)c1 |
| InChI | InChI=1S/C29H34F3N5O6/c1-15-11-12-18(29(30,31)32)19(13-15)37-25(33-16(2)36-37)24-22(38)21(34-35-27(39)43-28(3,4)5)23-20(41-24)14-40-26(42-23)17-9-7-6-8-10-17/h6-13,20-24,26,34,38H,14H2,1-5H3,(H,35,39) |
| InChIKey | WYOKVRNRQWAEID-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|