C22H19ClF3N7O4 — CID 174084573
(6S,8aR)-8-azido-6-[2-[5-chloro-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 174084573) has the molecular formula C22H19ClF3N7O4 and a molecular weight of 537.89 g/mol. Its IUPAC name is (6S,8aR)-8-azido-6-[2-[5-chloro-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6S,8aR)-8-azido-6-[2-[5-chloro-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 174084573 |
| Molecular Formula | C22H19ClF3N7O4 |
| Molecular Weight | 537.89 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (6S,8aR)-8-azido-6-[2-[5-chloro-2-(trifluoromethyl)-3-pyridinyl]-5-methyl-1,2,4-triazol-3-yl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | Cc1nc([C@@H]2OC3COC(c4ccccc4)O[C@@H]3C(N=[N+]=[N-])C2O)n(-c2cc(Cl)cnc2C(F)(F)F)n1 |
| InChI | InChI=1S/C22H19ClF3N7O4/c1-10-29-20(33(31-10)13-7-12(23)8-28-19(13)22(24,25)26)18-16(34)15(30-32-27)17-14(36-18)9-35-21(37-17)11-5-3-2-4-6-11/h2-8,14-18,21,34H,9H2,1H3/t14?,15?,16?,17-,18+,21?/m0/s1 |
| InChIKey | KEONMASSLQKKJS-JKQUEYGFSA-N |
| XLogP | 4.24 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|