C25H20ClF3N6O4 — CID 174226780
5-[(4aR,6S,7R,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile (PubChem CID 174226780) has the molecular formula C25H20ClF3N6O4 and a molecular weight of 560.92 g/mol. Its IUPAC name is 5-[(4aR,6S,7R,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile.
| Compound Name | 5-[(4aR,6S,7R,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 174226780 |
| Molecular Formula | C25H20ClF3N6O4 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 5-[(4aR,6S,7R,8R,8aR)-8-azido-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-[5-chloro-2-(trifluoromethyl)phenyl]pyrazole-3-carbonitrile |
| SMILES | CO[C@@H]1[C@@H](N=[N+]=[N-])[C@H]2OC(c3ccccc3)OC[C@H]2O[C@H]1c1cc(C#N)nn1-c1cc(Cl)ccc1C(F)(F)F |
| InChI | InChI=1S/C25H20ClF3N6O4/c1-36-23-20(32-34-31)22-19(12-37-24(39-22)13-5-3-2-4-6-13)38-21(23)18-10-15(11-30)33-35(18)17-9-14(26)7-8-16(17)25(27,28)29/h2-10,19-24H,12H2,1H3/t19-,20+,21+,22+,23-,24?/m1/s1 |
| InChIKey | QKILOZOZKXMTNW-NUUZCBFRSA-N |
| XLogP | 5.66 |
| TPSA | 127.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|