C18H16Br2N4O4S — CID 162700035
(6R,8R,8aR)-8-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol (PubChem CID 162700035) has the molecular formula C18H16Br2N4O4S and a molecular weight of 544.23 g/mol. Its IUPAC name is (6R,8R,8aR)-8-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol.
| Compound Name | (6R,8R,8aR)-8-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
|---|---|
| PubChem CID | 162700035 |
| Molecular Formula | C18H16Br2N4O4S |
| Molecular Weight | 544.23 g/mol |
| Exact Mass | 541.93 |
| IUPAC Name | (6R,8R,8aR)-8-azido-6-[(2,5-dibromo-3-pyridinyl)sulfanyl]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-ol |
| SMILES | [N-]=[N+]=N[C@@H]1C(O)[C@@H](Sc2cc(Br)cnc2Br)OC2COC(c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C18H16Br2N4O4S/c19-10-6-12(16(20)22-7-10)29-18-14(25)13(23-24-21)15-11(27-18)8-26-17(28-15)9-4-2-1-3-5-9/h1-7,11,13-15,17-18,25H,8H2/t11?,13-,14?,15+,17?,18-/m1/s1 |
| InChIKey | IOMTUPXAAFATSY-IHNZVMEPSA-N |
| XLogP | 4.58 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.23 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|