C16H20N4O6 — CID 138516566
(2S,4aR,6R,7R,8aR)-8-azido-7-hydroxy-N-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide (PubChem CID 138516566) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8aR)-8-azido-7-hydroxy-N-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide.
| Compound Name | (2S,4aR,6R,7R,8aR)-8-azido-7-hydroxy-N-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
|---|---|
| PubChem CID | 138516566 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (2S,4aR,6R,7R,8aR)-8-azido-7-hydroxy-N-methoxy-N-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1O[C@@H]2CO[C@H](c3ccccc3)O[C@@H]2C(N=[N+]=[N-])[C@H]1O |
| InChI | InChI=1S/C16H20N4O6/c1-20(23-2)15(22)14-12(21)11(18-19-17)13-10(25-14)8-24-16(26-13)9-6-4-3-5-7-9/h3-7,10-14,16,21H,8H2,1-2H3/t10-,11?,12-,13+,14-,16+/m1/s1 |
| InChIKey | IAHBSMDIFLOEHS-CUKGUQRMSA-N |
| XLogP | 0.93 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|