C26H28Cl3NO7 — CID 135017387
2,2,2-trichloroethyl N-[(6S,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 135017387) has the molecular formula C26H28Cl3NO7 and a molecular weight of 572.87 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(6S,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(6S,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 135017387 |
| Molecular Formula | C26H28Cl3NO7 |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(6S,8aS)-2-phenyl-8-phenylmethoxy-6-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | C=CCO[C@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H28Cl3NO7/c1-2-13-32-24-20(30-25(31)35-16-26(27,28)29)22(33-14-17-9-5-3-6-10-17)21-19(36-24)15-34-23(37-21)18-11-7-4-8-12-18/h2-12,19-24H,1,13-16H2,(H,30,31)/t19?,20?,21-,22?,23?,24+/m1/s1 |
| InChIKey | CVEOXIHKXXOFQP-DYNXZRPGSA-N |
| XLogP | 5.08 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|