C32H35NO8 — CID 10886238
benzyl N-[(2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 10886238) has the molecular formula C32H35NO8 and a molecular weight of 561.63 g/mol. Its IUPAC name is benzyl N-[(2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | benzyl N-[(2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 10886238 |
| Molecular Formula | C32H35NO8 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | benzyl N-[(2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | C=CCO[C@@H]1[C@@H](NC(=O)OCc2ccccc2)[C@@H](OCc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3OC)O[C@@H]12 |
| InChI | InChI=1S/C32H35NO8/c1-3-18-36-29-27(33-32(34)39-20-23-14-8-5-9-15-23)31(37-19-22-12-6-4-7-13-22)40-26-21-38-30(41-28(26)29)24-16-10-11-17-25(24)35-2/h3-17,26-31H,1,18-21H2,2H3,(H,33,34)/t26-,27-,28-,29-,30-,31+/m1/s1 |
| InChIKey | XOESQNZYBGLEPM-NHMJYFFGSA-N |
| XLogP | 4.92 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|