C25H31NO6 — CID 11812250
(2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-N-methyl-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 11812250) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-N-methyl-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-N-methyl-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 11812250 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (2R,4aR,6S,7R,8R,8aS)-2-(2-methoxyphenyl)-N-methyl-6-phenylmethoxy-8-prop-2-enoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | C=CCO[C@@H]1[C@@H](NC)[C@@H](OCc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3OC)O[C@@H]12 |
| InChI | InChI=1S/C25H31NO6/c1-4-14-28-23-21(26-2)25(29-15-17-10-6-5-7-11-17)31-20-16-30-24(32-22(20)23)18-12-8-9-13-19(18)27-3/h4-13,20-26H,1,14-16H2,2-3H3/t20-,21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | IONUNIROEQQHNV-CRNSPECLSA-N |
| XLogP | 3.21 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|