C34H38Cl3NO8 — CID 139836759
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate (PubChem CID 139836759) has the molecular formula C34H38Cl3NO8 and a molecular weight of 695.04 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 139836759 |
| Molecular Formula | C34H38Cl3NO8 |
| Molecular Weight | 695.04 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethoxymethyl)-2-prop-2-enoxyoxan-3-yl]carbamate |
| SMILES | C=CCO[C@H]1O[C@H](COCOCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C34H38Cl3NO8/c1-2-18-42-32-29(38-33(39)45-23-34(35,36)37)31(44-21-27-16-10-5-11-17-27)30(43-20-26-14-8-4-9-15-26)28(46-32)22-41-24-40-19-25-12-6-3-7-13-25/h2-17,28-32H,1,18-24H2,(H,38,39)/t28-,29-,30-,31-,32+/m1/s1 |
| InChIKey | PTPODKFGNJXLGU-ROQXEPJXSA-N |
| XLogP | 6.74 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.04 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|