C32H37NO6 — CID 66860325
N-[(2S,3S,4R,5S,6R)-2,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl]acetamide (PubChem CID 66860325) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6R)-2,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5S,6R)-2,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 66860325 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-[(2S,3S,4R,5S,6R)-2,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-prop-2-enoxyoxan-3-yl]acetamide |
| SMILES | C=CCO[C@@H]1[C@H](NC(C)=O)[C@@H](OCc2ccccc2)O[C@H](COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H37NO6/c1-3-19-36-31-29(33-24(2)34)32(38-22-27-17-11-6-12-18-27)39-28(23-35-20-25-13-7-4-8-14-25)30(31)37-21-26-15-9-5-10-16-26/h3-18,28-32H,1,19-23H2,2H3,(H,33,34)/t28-,29+,30-,31-,32+/m1/s1 |
| InChIKey | IAKNNAFWNCIOCG-BQCXQQNKSA-N |
| XLogP | 4.81 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|