C34H41NO6 — CID 15043143
N-[(2R,3R,4R,5S,6R)-2-pent-4-enoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 15043143) has the molecular formula C34H41NO6 and a molecular weight of 559.70 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-pent-4-enoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-pent-4-enoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 15043143 |
| Molecular Formula | C34H41NO6 |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.29 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-pent-4-enoxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | C=CCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C34H41NO6/c1-3-4-14-21-38-34-31(35-26(2)36)33(40-24-29-19-12-7-13-20-29)32(39-23-28-17-10-6-11-18-28)30(41-34)25-37-22-27-15-8-5-9-16-27/h3,5-13,15-20,30-34H,1,4,14,21-25H2,2H3,(H,35,36)/t30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | OSZGHSRUPJUWPE-SLXQPGMDSA-N |
| XLogP | 5.59 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|