C50H61NO11 — CID 58627410
[5-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-ethyl-2-pent-4-enoxy-4-phenylmethoxyoxan-3-yl] acetate (PubChem CID 58627410) has the molecular formula C50H61NO11 and a molecular weight of 852.03 g/mol. Its IUPAC name is [5-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-ethyl-2-pent-4-enoxy-4-phenylmethoxyoxan-3-yl] acetate.
| Compound Name | [5-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-ethyl-2-pent-4-enoxy-4-phenylmethoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 58627410 |
| Molecular Formula | C50H61NO11 |
| Molecular Weight | 852.03 g/mol |
| Exact Mass | 851.42 |
| IUPAC Name | [5-[3-acetamido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-6-ethyl-2-pent-4-enoxy-4-phenylmethoxyoxan-3-yl] acetate |
| SMILES | C=CCCCOC1OC(CC)C(OC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2NC(C)=O)C(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C50H61NO11/c1-5-7-20-29-55-50-48(59-36(4)53)47(58-33-40-27-18-11-19-28-40)45(41(6-2)60-50)62-49-43(51-35(3)52)46(57-32-39-25-16-10-17-26-39)44(56-31-38-23-14-9-15-24-38)42(61-49)34-54-30-37-21-12-8-13-22-37/h5,8-19,21-28,41-50H,1,6-7,20,29-34H2,2-4H3,(H,51,52) |
| InChIKey | OQHOBEINHILWIC-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 129.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.03 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|