C29H36O8 — CID 101146005
[(2R,3S,4S,5R,6R)-4-acetyloxy-6-pent-4-enoxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 101146005) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4-acetyloxy-6-pent-4-enoxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-4-acetyloxy-6-pent-4-enoxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101146005 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4-acetyloxy-6-pent-4-enoxy-3,5-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COC(C)=O)[C@H](OCc2ccccc2)[C@H](OC(C)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H36O8/c1-4-5-12-17-32-29-28(35-19-24-15-10-7-11-16-24)27(36-22(3)31)26(25(37-29)20-33-21(2)30)34-18-23-13-8-6-9-14-23/h4,6-11,13-16,25-29H,1,5,12,17-20H2,2-3H3/t25-,26+,27+,28-,29-/m1/s1 |
| InChIKey | JHYCWIQHKWDJCX-JYJZCUDQSA-N |
| XLogP | 4.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|