C33H43N3O15 — CID 11787437
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6S)-2-(acetyloxymethyl)-5-azido-6-pent-4-enoxy-4-phenylmethoxyoxan-3-yl]oxyoxane-2-carboxylate (PubChem CID 11787437) has the molecular formula C33H43N3O15 and a molecular weight of 721.71 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6S)-2-(acetyloxymethyl)-5-azido-6-pent-4-enoxy-4-phenylmethoxyoxan-3-yl]oxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6S)-2-(acetyloxymethyl)-5-azido-6-pent-4-enoxy-4-phenylmethoxyoxan-3-yl]oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11787437 |
| Molecular Formula | C33H43N3O15 |
| Molecular Weight | 721.71 g/mol |
| Exact Mass | 721.27 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R,3S,4R,5R,6S)-2-(acetyloxymethyl)-5-azido-6-pent-4-enoxy-4-phenylmethoxyoxan-3-yl]oxyoxane-2-carboxylate |
| SMILES | C=CCCCO[C@H]1O[C@H](COC(C)=O)[C@@H](O[C@@H]2O[C@H](C(=O)OC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C33H43N3O15/c1-7-8-12-15-43-32-24(35-36-34)26(45-16-22-13-10-9-11-14-22)25(23(49-32)17-44-18(2)37)50-33-30(48-21(5)40)28(47-20(4)39)27(46-19(3)38)29(51-33)31(41)42-6/h7,9-11,13-14,23-30,32-33H,1,8,12,15-17H2,2-6H3/t23-,24-,25-,26-,27+,28+,29+,30-,32+,33-/m1/s1 |
| InChIKey | ISYSPTFTFAYVDZ-ZFUZJJBJSA-N |
| XLogP | 2.60 |
| TPSA | 226.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|