C20H25N3O7 — CID 102245198
[(2R,3S,4R,5R)-6-acetyloxy-5-azido-4-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]methyl acetate (PubChem CID 102245198) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-6-acetyloxy-5-azido-4-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-6-acetyloxy-5-azido-4-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102245198 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(2R,3S,4R,5R)-6-acetyloxy-5-azido-4-phenylmethoxy-3-prop-2-enoxyoxan-2-yl]methyl acetate |
| SMILES | C=CCO[C@H]1[C@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])C(OC(C)=O)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C20H25N3O7/c1-4-10-26-18-16(12-27-13(2)24)30-20(29-14(3)25)17(22-23-21)19(18)28-11-15-8-6-5-7-9-15/h4-9,16-20H,1,10-12H2,2-3H3/t16-,17-,18-,19-,20?/m1/s1 |
| InChIKey | JTPYVJSEKIEZQG-MGXUXCEGSA-N |
| XLogP | 2.67 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|