C21H27FO7 — CID 102123959
[(2R,3R,4S,5R)-6-fluorooxy-5-phenylmethoxy-3,4-bis(prop-2-enoxy)oxan-2-yl]methyl acetate (PubChem CID 102123959) has the molecular formula C21H27FO7 and a molecular weight of 410.44 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-fluorooxy-5-phenylmethoxy-3,4-bis(prop-2-enoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-6-fluorooxy-5-phenylmethoxy-3,4-bis(prop-2-enoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102123959 |
| Molecular Formula | C21H27FO7 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [(2R,3R,4S,5R)-6-fluorooxy-5-phenylmethoxy-3,4-bis(prop-2-enoxy)oxan-2-yl]methyl acetate |
| SMILES | C=CCO[C@H]1[C@H](OCC=C)[C@@H](OCc2ccccc2)C(OF)O[C@@H]1COC(C)=O |
| InChI | InChI=1S/C21H27FO7/c1-4-11-24-18-17(14-26-15(3)23)28-21(29-22)20(19(18)25-12-5-2)27-13-16-9-7-6-8-10-16/h4-10,17-21H,1-2,11-14H2,3H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | SHWYFKLHPODXRE-AWGDKMGJSA-N |
| XLogP | 2.90 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|