C30H34O6 — CID 163477744
[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 163477744) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is [(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163477744 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | [(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(C)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C30H34O6/c1-22-28(33-18-24-12-6-3-7-13-24)30(35-20-26-16-10-5-11-17-26)29(27(36-22)21-32-23(2)31)34-19-25-14-8-4-9-15-25/h3-17,22,27-30H,18-21H2,1-2H3/t22?,27-,28+,29?,30?/m0/s1 |
| InChIKey | CBXFNGIRPWEDDR-BDRGHIBYSA-N |
| XLogP | 5.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |