C29H32O7 — CID 153310904
[(3S,4S,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 153310904) has the molecular formula C29H32O7 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(3S,4S,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 153310904 |
| Molecular Formula | C29H32O7 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | [(3S,4S,6R)-6-hydroxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](O)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O7/c1-21(30)32-20-25-26(33-17-22-11-5-2-6-12-22)27(34-18-23-13-7-3-8-14-23)28(29(31)36-25)35-19-24-15-9-4-10-16-24/h2-16,25-29,31H,17-20H2,1H3/t25?,26-,27-,28?,29+/m0/s1 |
| InChIKey | RWWBTSOKCOYZSF-PZJXGPBESA-N |
| XLogP | 4.02 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |