C35H36O6Se — CID 16754803
[(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxan-2-yl]methyl acetate (PubChem CID 16754803) has the molecular formula C35H36O6Se and a molecular weight of 631.63 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 16754803 |
| Molecular Formula | C35H36O6Se |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 632.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-phenylselanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([Se]c2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H36O6Se/c1-26(36)37-25-31-32(38-22-27-14-6-2-7-15-27)33(39-23-28-16-8-3-9-17-28)34(40-24-29-18-10-4-11-19-29)35(41-31)42-30-20-12-5-13-21-30/h2-21,31-35H,22-25H2,1H3/t31-,32-,33+,34-,35+/m1/s1 |
| InChIKey | MAQMYQHMWXEDSI-KJQSSVQNSA-N |
| XLogP | 5.06 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|