C17H20O7Se — CID 10693172
[(2S,3R,4S,5R)-3,4-diacetyloxy-5-phenylselanyloxolan-2-yl]methyl acetate (PubChem CID 10693172) has the molecular formula C17H20O7Se and a molecular weight of 415.30 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-diacetyloxy-5-phenylselanyloxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R)-3,4-diacetyloxy-5-phenylselanyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10693172 |
| Molecular Formula | C17H20O7Se |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-diacetyloxy-5-phenylselanyloxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H]([Se]c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H20O7Se/c1-10(18)21-9-14-15(22-11(2)19)16(23-12(3)20)17(24-14)25-13-7-5-4-6-8-13/h4-8,14-17H,9H2,1-3H3/t14-,15+,16-,17+/m0/s1 |
| InChIKey | CSSMHRVGPADUKA-VVLHAWIVSA-N |
| XLogP | 0.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|