C22H28O9SSe — CID 58884082
[3,4,5-triacetyloxy-6-(benzylsulfanylmethylselanyl)oxan-2-yl]methyl acetate (PubChem CID 58884082) has the molecular formula C22H28O9SSe and a molecular weight of 547.48 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(benzylsulfanylmethylselanyl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(benzylsulfanylmethylselanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58884082 |
| Molecular Formula | C22H28O9SSe |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(benzylsulfanylmethylselanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC([Se]CSCc2ccccc2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H28O9SSe/c1-13(23)27-10-18-19(28-14(2)24)20(29-15(3)25)21(30-16(4)26)22(31-18)33-12-32-11-17-8-6-5-7-9-17/h5-9,18-22H,10-12H2,1-4H3 |
| InChIKey | QGCOBYYHXQVLRV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|