C22H28O9Se — CID 102459873
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-phenylethylselanyl)oxan-2-yl]methyl acetate (PubChem CID 102459873) has the molecular formula C22H28O9Se and a molecular weight of 515.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-phenylethylselanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-phenylethylselanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102459873 |
| Molecular Formula | C22H28O9Se |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(2-phenylethylselanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]([Se]CCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H28O9Se/c1-13(23)27-12-18-19(28-14(2)24)20(29-15(3)25)21(30-16(4)26)22(31-18)32-11-10-17-8-6-5-7-9-17/h5-9,18-22H,10-12H2,1-4H3/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | HPAFWTVNNHPNSY-BDHVOXNPSA-N |
| XLogP | 1.43 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|