C19H24O9S — CID 101378190
[(2R,3R,4R,5S)-3,4-diacetyloxy-5-(benzylsulfonylmethyl)oxolan-2-yl]methyl acetate (PubChem CID 101378190) has the molecular formula C19H24O9S and a molecular weight of 428.46 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(benzylsulfonylmethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(benzylsulfonylmethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101378190 |
| Molecular Formula | C19H24O9S |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4-diacetyloxy-5-(benzylsulfonylmethyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](CS(=O)(=O)Cc2ccccc2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H24O9S/c1-12(20)25-9-16-18(26-13(2)21)19(27-14(3)22)17(28-16)11-29(23,24)10-15-7-5-4-6-8-15/h4-8,16-19H,9-11H2,1-3H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | KRVWCQOVPXNTPV-MKXGPGLRSA-N |
| XLogP | 0.80 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|