C22H27NO10 — CID 124717891
[(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 124717891) has the molecular formula C22H27NO10 and a molecular weight of 465.46 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124717891 |
| Molecular Formula | C22H27NO10 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OC(C)=O)[C@H](NC(=O)Cc2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H27NO10/c1-12(24)29-11-17-20(30-13(2)25)21(31-14(3)26)19(22(33-17)32-15(4)27)23-18(28)10-16-8-6-5-7-9-16/h5-9,17,19-22H,10-11H2,1-4H3,(H,23,28)/t17-,19+,20+,21+,22-/m0/s1 |
| InChIKey | AKVNMGYKMZDLSO-NBYDKTAJSA-N |
| XLogP | 0.43 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|