C19H23NO11 — CID 124528026
[(2S,3S,4S,5R,6R)-3,4,6-triacetyloxy-5-(furan-2-carbonylamino)oxan-2-yl]methyl acetate (PubChem CID 124528026) has the molecular formula C19H23NO11 and a molecular weight of 441.39 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3,4,6-triacetyloxy-5-(furan-2-carbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4S,5R,6R)-3,4,6-triacetyloxy-5-(furan-2-carbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124528026 |
| Molecular Formula | C19H23NO11 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3,4,6-triacetyloxy-5-(furan-2-carbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OC(C)=O)[C@H](NC(=O)c2ccco2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H23NO11/c1-9(21)27-8-14-16(28-10(2)22)17(29-11(3)23)15(19(31-14)30-12(4)24)20-18(25)13-6-5-7-26-13/h5-7,14-17,19H,8H2,1-4H3,(H,20,25)/t14-,15+,16+,17-,19-/m0/s1 |
| InChIKey | RDSVABCHEGNUBB-ATIFRJIPSA-N |
| XLogP | 0.09 |
| TPSA | 156.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|