C21H26N2O10 — CID 140874692
[(3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-aminobenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 140874692) has the molecular formula C21H26N2O10 and a molecular weight of 466.44 g/mol. Its IUPAC name is [(3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-aminobenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-aminobenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 140874692 |
| Molecular Formula | C21H26N2O10 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | [(3S,4R,5S)-3,4,6-triacetyloxy-5-[(2-aminobenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)[C@@H](NC(=O)c2ccccc2N)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26N2O10/c1-10(24)29-9-16-18(30-11(2)25)19(31-12(3)26)17(21(33-16)32-13(4)27)23-20(28)14-7-5-6-8-15(14)22/h5-8,16-19,21H,9,22H2,1-4H3,(H,23,28)/t16?,17-,18+,19+,21?/m0/s1 |
| InChIKey | SWDIUPMIHVGBBG-LWLVAEKPSA-N |
| XLogP | 0.08 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|