C21H24FNO10 — CID 129421492
[(2S,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-[(4-fluorobenzoyl)amino]oxan-2-yl]methyl acetate (PubChem CID 129421492) has the molecular formula C21H24FNO10 and a molecular weight of 469.42 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-[(4-fluorobenzoyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-[(4-fluorobenzoyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129421492 |
| Molecular Formula | C21H24FNO10 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-3,4,6-triacetyloxy-5-[(4-fluorobenzoyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OC(C)=O)[C@H](NC(=O)c2ccc(F)cc2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H24FNO10/c1-10(24)29-9-16-18(30-11(2)25)19(31-12(3)26)17(21(33-16)32-13(4)27)23-20(28)14-5-7-15(22)8-6-14/h5-8,16-19,21H,9H2,1-4H3,(H,23,28)/t16-,17+,18-,19+,21-/m0/s1 |
| InChIKey | RWQFFEUEHMUXCL-XQPJFTJZSA-N |
| XLogP | 0.64 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|